C17H24O2 — CID 134941614
(3S,4aS,8aR)-8a-ethenyl-3-prop-1-en-2-ylspiro[1,2,3,4,4a,5-hexahydronaphthalene-6,2'-1,3-dioxolane] (PubChem CID 134941614) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (3S,4aS,8aR)-8a-ethenyl-3-prop-1-en-2-ylspiro[1,2,3,4,4a,5-hexahydronaphthalene-6,2'-1,3-dioxolane].
| Compound Name | (3S,4aS,8aR)-8a-ethenyl-3-prop-1-en-2-ylspiro[1,2,3,4,4a,5-hexahydronaphthalene-6,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 134941614 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (3S,4aS,8aR)-8a-ethenyl-3-prop-1-en-2-ylspiro[1,2,3,4,4a,5-hexahydronaphthalene-6,2'-1,3-dioxolane] |
| SMILES | C=C[C@@]12C=CC3(C[C@@H]1C[C@@H](C(=C)C)CC2)OCCO3 |
| InChI | InChI=1S/C17H24O2/c1-4-16-6-5-14(13(2)3)11-15(16)12-17(8-7-16)18-9-10-19-17/h4,7-8,14-15H,1-2,5-6,9-12H2,3H3/t14-,15-,16+/m0/s1 |
| InChIKey | PIPKHOBYOPPOLC-HRCADAONSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|