C24H26N6O5 — CID 134941654
8-[2-(4-phenyltriazol-1-yl)acetyl]-2,14-dioxa-5,8,11-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-4,12-dione (PubChem CID 134941654) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is 8-[2-(4-phenyltriazol-1-yl)acetyl]-2,14-dioxa-5,8,11-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-4,12-dione.
| Compound Name | 8-[2-(4-phenyltriazol-1-yl)acetyl]-2,14-dioxa-5,8,11-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-4,12-dione |
|---|---|
| PubChem CID | 134941654 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 8-[2-(4-phenyltriazol-1-yl)acetyl]-2,14-dioxa-5,8,11-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-4,12-dione |
| SMILES | O=C1COc2ccccc2OCC(=O)NCCN(C(=O)Cn2cc(-c3ccccc3)nn2)CCN1 |
| InChI | InChI=1S/C24H26N6O5/c31-22-16-34-20-8-4-5-9-21(20)35-17-23(32)26-11-13-29(12-10-25-22)24(33)15-30-14-19(27-28-30)18-6-2-1-3-7-18/h1-9,14H,10-13,15-17H2,(H,25,31)(H,26,32) |
| InChIKey | OGRXOSKWHHLPKC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |