C27H44O4Si — CID 134941679
(4aR,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2,5-dimethoxyphenyl)-1,1-dimethyl-3,4,4a,5,6,9-hexahydro-2H-benzo[7]annulen-9a-ol (PubChem CID 134941679) has the molecular formula C27H44O4Si and a molecular weight of 460.73 g/mol. Its IUPAC name is (4aR,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2,5-dimethoxyphenyl)-1,1-dimethyl-3,4,4a,5,6,9-hexahydro-2H-benzo[7]annulen-9a-ol.
| Compound Name | (4aR,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2,5-dimethoxyphenyl)-1,1-dimethyl-3,4,4a,5,6,9-hexahydro-2H-benzo[7]annulen-9a-ol |
|---|---|
| PubChem CID | 134941679 |
| Molecular Formula | C27H44O4Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (4aR,5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-(2,5-dimethoxyphenyl)-1,1-dimethyl-3,4,4a,5,6,9-hexahydro-2H-benzo[7]annulen-9a-ol |
| SMILES | COc1ccc(OC)c([C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=CCC3(O)[C@@H]2CCCC3(C)C)c1 |
| InChI | InChI=1S/C27H44O4Si/c1-25(2,3)32(8,9)31-23-13-11-17-27(28)21(12-10-16-26(27,4)5)24(23)20-18-19(29-6)14-15-22(20)30-7/h11,13-15,18,21,23-24,28H,10,12,16-17H2,1-9H3/t21-,23+,24-,27?/m1/s1 |
| InChIKey | SMYOGNHYBGQCAU-OIEXWRJMSA-N |
| XLogP | 6.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|