About N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine
N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine (PubChem CID 134941715) has the molecular formula C14H29NS2
and a molecular weight of 275.53 g/mol. Its IUPAC name is N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine |
| PubChem CID | 134941715 |
| Molecular Formula | C14H29NS2 |
| Molecular Weight | 275.53 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine |
| SMILES | CCCCC(CC1SCCCS1)NC(C)CC |
| InChI | InChI=1S/C14H29NS2/c1-4-6-8-13(15-12(3)5-2)11-14-16-9-7-10-17-14/h12-15H,4-11H2,1-3H3 |
| InChIKey | AQVUEHQMJBAKOP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine?
The IUPAC name of N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine (CID 134941715) is N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine.
What is the SMILES notation for N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine?
The canonical SMILES for N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine is CCCCC(CC1SCCCS1)NC(C)CC.
What is the InChIKey of N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine?
The InChIKey is AQVUEHQMJBAKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NS2/c1-4-6-8-13(15-12(3)5-2)11-14-16-9-7-10-17-14/h12-15H,4-11H2,1-3H3.
What are the key properties of N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine?
N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine has a molecular weight of 275.53 g/mol, XLogP of 4.52, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1-(1,3-dithian-2-yl)hexan-2-amine is sourced from PubChem (CID 134941715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).