C22H10F10N2O — CID 134941752
(2,3,4,5,6-pentafluorophenyl)-[4-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]methanol (PubChem CID 134941752) has the molecular formula C22H10F10N2O and a molecular weight of 508.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[4-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]methanol.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[4-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]methanol |
|---|---|
| PubChem CID | 134941752 |
| Molecular Formula | C22H10F10N2O |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[4-[(2,3,4,5,6-pentafluorophenyl)-(1H-pyrrol-2-yl)methyl]-1H-pyrrol-2-yl]methanol |
| SMILES | OC(c1cc(C(c2ccc[nH]2)c2c(F)c(F)c(F)c(F)c2F)c[nH]1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H10F10N2O/c23-12-10(13(24)17(28)20(31)16(12)27)9(7-2-1-3-33-7)6-4-8(34-5-6)22(35)11-14(25)18(29)21(32)19(30)15(11)26/h1-5,9,22,33-35H |
| InChIKey | PGJIYHMZWOJBFL-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|