C13H13NO2 — CID 134941861
3-[(1Z)-2-phenylbuta-1,3-dienyl]-1,3-oxazolidin-2-one (PubChem CID 134941861) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-[(1Z)-2-phenylbuta-1,3-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1Z)-2-phenylbuta-1,3-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134941861 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-[(1Z)-2-phenylbuta-1,3-dienyl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C(=C/N1CCOC1=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO2/c1-2-11(12-6-4-3-5-7-12)10-14-8-9-16-13(14)15/h2-7,10H,1,8-9H2/b11-10- |
| InChIKey | CGWXWCZGLHPOML-KHPPLWFESA-N |
| XLogP | 2.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|