C27H50O4Si — CID 134941908
[(3Z,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 134941908) has the molecular formula C27H50O4Si and a molecular weight of 466.78 g/mol. Its IUPAC name is [(3Z,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3Z,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134941908 |
| Molecular Formula | C27H50O4Si |
| Molecular Weight | 466.78 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | [(3Z,5Z)-7-ethoxy-3,4,5-tris(ethoxymethyl)hepta-3,5-dien-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | CCOC/C=C(COCC)/C(COCC)=C(\C#C[Si](C(C)C)(C(C)C)C(C)C)COCC |
| InChI | InChI=1S/C27H50O4Si/c1-11-28-17-15-25(19-29-12-2)27(21-31-14-4)26(20-30-13-3)16-18-32(22(5)6,23(7)8)24(9)10/h15,22-24H,11-14,17,19-21H2,1-10H3/b25-15+,27-26+ |
| InChIKey | ZNDLPMPDPIHQAY-RVTFTXCGSA-N |
| XLogP | 6.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.78 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|