C8H13N — CID 134942012
(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 134942012) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 134942012 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | C1=C[C@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C8H13N/c1-2-4-8-7(3-1)5-6-9-8/h5-9H,1-4H2/t7-,8-/m1/s1 |
| InChIKey | HORKPTPCTNTBNF-HTQZYQBOSA-N |
| XLogP | 1.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |