C17H30O3 — CID 134942052
2-[(E)-4-(5-methyl-2-propan-2-ylcyclohexyl)oxybut-1-enyl]-1,3-dioxolane (PubChem CID 134942052) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2-[(E)-4-(5-methyl-2-propan-2-ylcyclohexyl)oxybut-1-enyl]-1,3-dioxolane.
| Compound Name | 2-[(E)-4-(5-methyl-2-propan-2-ylcyclohexyl)oxybut-1-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 134942052 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2-[(E)-4-(5-methyl-2-propan-2-ylcyclohexyl)oxybut-1-enyl]-1,3-dioxolane |
| SMILES | CC1CCC(C(C)C)C(OCC/C=C/C2OCCO2)C1 |
| InChI | InChI=1S/C17H30O3/c1-13(2)15-8-7-14(3)12-16(15)18-9-5-4-6-17-19-10-11-20-17/h4,6,13-17H,5,7-12H2,1-3H3/b6-4+ |
| InChIKey | GHMMMIJLNWWTJX-GQCTYLIASA-N |
| XLogP | 3.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|