About 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one
11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one (PubChem CID 134942059) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one.
Analyze 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one?
The IUPAC name of 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one (CID 134942059) is 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one.
What is the SMILES notation for 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one?
The canonical SMILES for 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one is CC1(C)COC2(CCC3(CCCC3=O)CC2)OC1.
What is the InChIKey of 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one?
The InChIKey is NSVWVYYVPXUDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-13(2)10-17-15(18-11-13)8-6-14(7-9-15)5-3-4-12(14)16/h3-11H2,1-2H3.
What are the key properties of 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one?
11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one has a molecular weight of 252.35 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11,11-dimethyl-9,13-dioxadispiro[4.2.58.25]pentadecan-4-one is sourced from PubChem (CID 134942059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).