C22H24O5S — CID 134942066
[(4R,5R)-2,2-dimethyl-5-(3-phenylprop-2-ynyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134942066) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is [(4R,5R)-2,2-dimethyl-5-(3-phenylprop-2-ynyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4R,5R)-2,2-dimethyl-5-(3-phenylprop-2-ynyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134942066 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(4R,5R)-2,2-dimethyl-5-(3-phenylprop-2-ynyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(C)(C)O[C@@H]2CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24O5S/c1-17-12-14-19(15-13-17)28(23,24)25-16-21-20(26-22(2,3)27-21)11-7-10-18-8-5-4-6-9-18/h4-6,8-9,12-15,20-21H,11,16H2,1-3H3/t20-,21-/m1/s1 |
| InChIKey | XCTWZBPBFDHZDK-NHCUHLMSSA-N |
| XLogP | 3.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|