C13H20O2 — CID 134942067
methyl (4S,5R,6aR)-5-ethyl-4-methyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate (PubChem CID 134942067) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is methyl (4S,5R,6aR)-5-ethyl-4-methyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate.
| Compound Name | methyl (4S,5R,6aR)-5-ethyl-4-methyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate |
|---|---|
| PubChem CID | 134942067 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | methyl (4S,5R,6aR)-5-ethyl-4-methyl-1,3a,4,5,6,6a-hexahydropentalene-2-carboxylate |
| SMILES | CC[C@@H]1C[C@@H]2CC(C(=O)OC)=CC2[C@H]1C |
| InChI | InChI=1S/C13H20O2/c1-4-9-5-10-6-11(13(14)15-3)7-12(10)8(9)2/h7-10,12H,4-6H2,1-3H3/t8-,9+,10+,12?/m0/s1 |
| InChIKey | BZOZLGNYXLZCBP-BCGUWXCSSA-N |
| XLogP | 2.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |