C32H40N2O2+2 — CID 134942082
1-[[3,6-dibutoxy-7-[(4-methylpyridin-1-ium-1-yl)methyl]naphthalen-2-yl]methyl]-4-methylpyridin-1-ium (PubChem CID 134942082) has the molecular formula C32H40N2O2+2 and a molecular weight of 484.68 g/mol. Its IUPAC name is 1-[[3,6-dibutoxy-7-[(4-methylpyridin-1-ium-1-yl)methyl]naphthalen-2-yl]methyl]-4-methylpyridin-1-ium.
| Compound Name | 1-[[3,6-dibutoxy-7-[(4-methylpyridin-1-ium-1-yl)methyl]naphthalen-2-yl]methyl]-4-methylpyridin-1-ium |
|---|---|
| PubChem CID | 134942082 |
| Molecular Formula | C32H40N2O2+2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 1-[[3,6-dibutoxy-7-[(4-methylpyridin-1-ium-1-yl)methyl]naphthalen-2-yl]methyl]-4-methylpyridin-1-ium |
| SMILES | CCCCOc1cc2cc(OCCCC)c(C[n+]3ccc(C)cc3)cc2cc1C[n+]1ccc(C)cc1 |
| InChI | InChI=1S/C32H40N2O2/c1-5-7-17-35-31-21-28-22-32(36-18-8-6-2)30(24-34-15-11-26(4)12-16-34)20-27(28)19-29(31)23-33-13-9-25(3)10-14-33/h9-16,19-22H,5-8,17-18,23-24H2,1-4H3/q+2 |
| InChIKey | LBAUDJUDLZBNEI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|