C18H21NO4 — CID 134942241
3-[(1E,8Z)-9-hydroxy-7-oxo-9-phenylnona-1,8-dienyl]-1,3-oxazolidin-2-one (PubChem CID 134942241) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[(1E,8Z)-9-hydroxy-7-oxo-9-phenylnona-1,8-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1E,8Z)-9-hydroxy-7-oxo-9-phenylnona-1,8-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134942241 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-[(1E,8Z)-9-hydroxy-7-oxo-9-phenylnona-1,8-dienyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C(\O)c1ccccc1)CCCC/C=C/N1CCOC1=O |
| InChI | InChI=1S/C18H21NO4/c20-16(14-17(21)15-8-4-3-5-9-15)10-6-1-2-7-11-19-12-13-23-18(19)22/h3-5,7-9,11,14,21H,1-2,6,10,12-13H2/b11-7+,17-14- |
| InChIKey | BHGGMSMGFAJSPU-LNUOCBTKSA-N |
| XLogP | 3.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|