C25H33NO7 — CID 134942289
2-O-tert-butyl 4-O-prop-2-enyl (3R,4R,5S)-5-(2-oxo-2-prop-2-enoxyethyl)-3-(2-phenylethyl)-1,2-oxazolidine-2,4-dicarboxylate (PubChem CID 134942289) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-prop-2-enyl (3R,4R,5S)-5-(2-oxo-2-prop-2-enoxyethyl)-3-(2-phenylethyl)-1,2-oxazolidine-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-prop-2-enyl (3R,4R,5S)-5-(2-oxo-2-prop-2-enoxyethyl)-3-(2-phenylethyl)-1,2-oxazolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134942289 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-O-tert-butyl 4-O-prop-2-enyl (3R,4R,5S)-5-(2-oxo-2-prop-2-enoxyethyl)-3-(2-phenylethyl)-1,2-oxazolidine-2,4-dicarboxylate |
| SMILES | C=CCOC(=O)C[C@@H]1ON(C(=O)OC(C)(C)C)[C@H](CCc2ccccc2)[C@H]1C(=O)OCC=C |
| InChI | InChI=1S/C25H33NO7/c1-6-15-30-21(27)17-20-22(23(28)31-16-7-2)19(14-13-18-11-9-8-10-12-18)26(33-20)24(29)32-25(3,4)5/h6-12,19-20,22H,1-2,13-17H2,3-5H3/t19-,20+,22-/m1/s1 |
| InChIKey | SVSNKEJNQQMOAO-RZUBCFFCSA-N |
| XLogP | 4.00 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|