C22H29NO7 — CID 134942290
2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclohexyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate (PubChem CID 134942290) has the molecular formula C22H29NO7 and a molecular weight of 419.47 g/mol. Its IUPAC name is 2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclohexyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate.
| Compound Name | 2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclohexyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134942290 |
| Molecular Formula | C22H29NO7 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2-O-benzyl 4-O-methyl (3R,4R,5S)-3-cyclohexyl-5-(2-methoxy-2-oxoethyl)-1,2-oxazolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C[C@@H]1ON(C(=O)OCc2ccccc2)[C@H](C2CCCCC2)[C@H]1C(=O)OC |
| InChI | InChI=1S/C22H29NO7/c1-27-18(24)13-17-19(21(25)28-2)20(16-11-7-4-8-12-16)23(30-17)22(26)29-14-15-9-5-3-6-10-15/h3,5-6,9-10,16-17,19-20H,4,7-8,11-14H2,1-2H3/t17-,19-,20+/m0/s1 |
| InChIKey | YWAXKFIMQCPUEH-YSIASYRMSA-N |
| XLogP | 3.24 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|