About [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate
[(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate (PubChem CID 134942314) has the molecular formula C15H28O2Sn
and a molecular weight of 359.10 g/mol. Its IUPAC name is [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate |
| PubChem CID | 134942314 |
| Molecular Formula | C15H28O2Sn |
| Molecular Weight | 359.10 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1CCC[C@@H](/C=C\[Sn](C)(C)C)C1 |
| InChI | InChI=1S/C12H19O2.3CH3.Sn/c1-4-10-6-5-7-11(8-10)14-12(13)9(2)3;;;;/h1,4,9-11H,5-8H2,2-3H3;3*1H3;/t10-,11+;;;;/m1..../s1 |
| InChIKey | IMXUOSOJCWXXHA-XTJLUVPXSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.10 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate?
The IUPAC name of [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate (CID 134942314) is [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate.
What is the SMILES notation for [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate?
The canonical SMILES for [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate is CC(C)C(=O)O[C@H]1CCC[C@@H](/C=C\[Sn](C)(C)C)C1.
What is the InChIKey of [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate?
The InChIKey is IMXUOSOJCWXXHA-XTJLUVPXSA-N. The full InChI is InChI=1S/C12H19O2.3CH3.Sn/c1-4-10-6-5-7-11(8-10)14-12(13)9(2)3;;;;/h1,4,9-11H,5-8H2,2-3H3;3*1H3;/t10-,11+;;;;/m1..../s1.
What are the key properties of [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate?
[(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate has a molecular weight of 359.10 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-[(Z)-2-trimethylstannylethenyl]cyclohexyl] 2-methylpropanoate is sourced from PubChem (CID 134942314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).