About (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide
(E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide (PubChem CID 134942327) has the molecular formula C10H18N2O4
and a molecular weight of 230.26 g/mol. Its IUPAC name is (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide.
Molecular Properties
| Compound Name | (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide |
| PubChem CID | 134942327 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide |
| SMILES | CON(C)C(=O)/C=C/[C@@H](C[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C10H18N2O4/c1-8(2)9(7-12(14)15)5-6-10(13)11(3)16-4/h5-6,8-9H,7H2,1-4H3/b6-5+/t9-/m0/s1 |
| InChIKey | DIOOZVBGWZVAQB-CYNONHLPSA-N |
| XLogP | 1.11 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide?
The IUPAC name of (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide (CID 134942327) is (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide.
What is the SMILES notation for (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide?
The canonical SMILES for (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide is CON(C)C(=O)/C=C/[C@@H](C[N+](=O)[O-])C(C)C.
What is the InChIKey of (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide?
The InChIKey is DIOOZVBGWZVAQB-CYNONHLPSA-N. The full InChI is InChI=1S/C10H18N2O4/c1-8(2)9(7-12(14)15)5-6-10(13)11(3)16-4/h5-6,8-9H,7H2,1-4H3/b6-5+/t9-/m0/s1.
What are the key properties of (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide?
(E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide has a molecular weight of 230.26 g/mol, XLogP of 1.11, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4S)-N-methoxy-N,5-dimethyl-4-(nitromethyl)hex-2-enamide is sourced from PubChem (CID 134942327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).