C8H6Co2S8 — CID 134942374
carbanide;bis(cobalt(3+));2-(4,5-disulfido-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dithiolate (PubChem CID 134942374) has the molecular formula C8H6Co2S8 and a molecular weight of 476.54 g/mol. Its IUPAC name is carbanide;bis(cobalt(3+));2-(4,5-disulfido-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dithiolate.
| Compound Name | carbanide;bis(cobalt(3+));2-(4,5-disulfido-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dithiolate |
|---|---|
| PubChem CID | 134942374 |
| Molecular Formula | C8H6Co2S8 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 475.69 |
| IUPAC Name | carbanide;bis(cobalt(3+));2-(4,5-disulfido-1,3-dithiol-2-ylidene)-1,3-dithiole-4,5-dithiolate |
| SMILES | [CH3-].[CH3-].[Co+3].[Co+3].[S-]C1=C([S-])SC(=C2SC([S-])=C([S-])S2)S1 |
| InChI | InChI=1S/C6H4S8.2CH3.2Co/c7-1-2(8)12-5(11-1)6-13-3(9)4(10)14-6;;;;/h7-10H;2*1H3;;/q;2*-1;2*+3/p-4 |
| InChIKey | CCFOCUQLDLTNLI-UHFFFAOYSA-J |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|