C35H67IO3Si2 — CID 134942377
tert-butyl-[(1E,4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-1-iodo-2,6,10-trimethylundeca-1,9-dien-4-yl]oxy-dimethylsilane (PubChem CID 134942377) has the molecular formula C35H67IO3Si2 and a molecular weight of 718.99 g/mol. Its IUPAC name is tert-butyl-[(1E,4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-1-iodo-2,6,10-trimethylundeca-1,9-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-1-iodo-2,6,10-trimethylundeca-1,9-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134942377 |
| Molecular Formula | C35H67IO3Si2 |
| Molecular Weight | 718.99 g/mol |
| Exact Mass | 718.37 |
| IUPAC Name | tert-butyl-[(1E,4R,5S,6R)-5-[(4S,5S)-4-ethenyl-5-tri(propan-2-yl)silyloxyoxolan-3-yl]-1-iodo-2,6,10-trimethylundeca-1,9-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H]1C([C@H]([C@H](C)CCC=C(C)C)[C@@H](C/C(C)=C/I)O[Si](C)(C)C(C)(C)C)CO[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H67IO3Si2/c1-17-30-31(23-37-34(30)39-41(25(4)5,26(6)7)27(8)9)33(29(11)20-18-19-24(2)3)32(21-28(10)22-36)38-40(15,16)35(12,13)14/h17,19,22,25-27,29-34H,1,18,20-21,23H2,2-16H3/b28-22+/t29-,30+,31?,32-,33+,34+/m1/s1 |
| InChIKey | YCMHKNNXSBHFRC-VXRZNFQCSA-N |
| XLogP | 12.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.99 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|