C17H24N2O4 — CID 134942399
1-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]-N-phenylmethanimine oxide (PubChem CID 134942399) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]-N-phenylmethanimine oxide.
| Compound Name | 1-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]-N-phenylmethanimine oxide |
|---|---|
| PubChem CID | 134942399 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-4-yl]-N-phenylmethanimine oxide |
| SMILES | CC(C)(C)OC(=O)N1C(/C=[N+](\[O-])c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C17H24N2O4/c1-16(2,3)23-15(20)19-14(12-22-17(19,4)5)11-18(21)13-9-7-6-8-10-13/h6-11,14H,12H2,1-5H3/b18-11- |
| InChIKey | MBJYBQKANFGEJQ-WQRHYEAKSA-N |
| XLogP | 3.27 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|