C22H20F6O — CID 134942402
(6R,7R,9S,10S)-4,5,11,12-tetramethylidene-1,8-bis(trifluoromethyl)-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane (PubChem CID 134942402) has the molecular formula C22H20F6O and a molecular weight of 414.39 g/mol. Its IUPAC name is (6R,7R,9S,10S)-4,5,11,12-tetramethylidene-1,8-bis(trifluoromethyl)-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane.
| Compound Name | (6R,7R,9S,10S)-4,5,11,12-tetramethylidene-1,8-bis(trifluoromethyl)-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane |
|---|---|
| PubChem CID | 134942402 |
| Molecular Formula | C22H20F6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (6R,7R,9S,10S)-4,5,11,12-tetramethylidene-1,8-bis(trifluoromethyl)-15-oxahexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadecane |
| SMILES | C=C1C(=C)[C@H]2CC1C1[C@H]2C2(C(F)(F)F)OC1(C(F)(F)F)C1C3C[C@@H](C(=C)C3=C)[C@H]12 |
| InChI | InChI=1S/C22H20F6O/c1-7-8(2)12-5-11(7)15-16(12)20(22(26,27)28)18-14-6-13(9(3)10(14)4)17(18)19(15,29-20)21(23,24)25/h11-18H,1-6H2/t11-,12?,13+,14?,15+,16?,17-,18?,19?,20? |
| InChIKey | MCEGXYODCUKAJP-XUISYRHESA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |