C48H64O12 — CID 134942461
tritert-butyl (1S,3S,4S,6R,7R)-4,6-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-7-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate (PubChem CID 134942461) has the molecular formula C48H64O12 and a molecular weight of 833.03 g/mol. Its IUPAC name is tritert-butyl (1S,3S,4S,6R,7R)-4,6-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-7-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate.
| Compound Name | tritert-butyl (1S,3S,4S,6R,7R)-4,6-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-7-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 134942461 |
| Molecular Formula | C48H64O12 |
| Molecular Weight | 833.03 g/mol |
| Exact Mass | 832.44 |
| IUPAC Name | tritert-butyl (1S,3S,4S,6R,7R)-4,6-dihydroxy-1-[(4R,5R)-5-methyl-6-phenyl-4-phenylmethoxyhexyl]-7-phenylmethoxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylate |
| SMILES | C[C@H](Cc1ccccc1)[C@@H](CCC[C@]12O[C@H](C(=O)OC(C)(C)C)[C@@](O)(C(=O)OC(C)(C)C)C(C(=O)OC(C)(C)C)(O1)[C@H](O)[C@H]2OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C48H64O12/c1-32(29-33-21-14-11-15-22-33)36(54-30-34-23-16-12-17-24-34)27-20-28-46-38(55-31-35-25-18-13-19-26-35)37(49)48(60-46,42(52)59-45(8,9)10)47(53,41(51)58-44(5,6)7)39(56-46)40(50)57-43(2,3)4/h11-19,21-26,32,36-39,49,53H,20,27-31H2,1-10H3/t32-,36-,37-,38-,39-,46+,47-,48?/m1/s1 |
| InChIKey | BZVACXMRVIALIT-QWSURVPUSA-N |
| XLogP | 7.19 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.03 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|