About 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate
5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate (PubChem CID 134942484) has the molecular formula C19H20O4
and a molecular weight of 312.37 g/mol. Its IUPAC name is 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate.
Molecular Properties
| Compound Name | 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate |
| PubChem CID | 134942484 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate |
| SMILES | COC(=O)C[C@@H](CC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O4/c1-22-18(20)12-17(16-10-6-3-7-11-16)13-19(21)23-14-15-8-4-2-5-9-15/h2-11,17H,12-14H2,1H3/t17-/m0/s1 |
| InChIKey | DQXPPXFJJBXUGJ-KRWDZBQOSA-N |
| XLogP | 3.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate?
The IUPAC name of 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate (CID 134942484) is 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate.
What is the SMILES notation for 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate?
The canonical SMILES for 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate is COC(=O)C[C@@H](CC(=O)OCc1ccccc1)c1ccccc1.
What is the InChIKey of 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate?
The InChIKey is DQXPPXFJJBXUGJ-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H20O4/c1-22-18(20)12-17(16-10-6-3-7-11-16)13-19(21)23-14-15-8-4-2-5-9-15/h2-11,17H,12-14H2,1H3/t17-/m0/s1.
What are the key properties of 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate?
5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate has a molecular weight of 312.37 g/mol, XLogP of 3.47, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-benzyl 1-O-methyl (3S)-3-phenylpentanedioate is sourced from PubChem (CID 134942484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).