C31H56O7Si — CID 134942492
(2R)-2-[(2R,3R,4R,5R,6R)-6-(1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl)-3,5-dihydroxy-4-methylheptan-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]-2,3-dihydropyran-6-one (PubChem CID 134942492) has the molecular formula C31H56O7Si and a molecular weight of 568.87 g/mol. Its IUPAC name is (2R)-2-[(2R,3R,4R,5R,6R)-6-(1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl)-3,5-dihydroxy-4-methylheptan-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(2R,3R,4R,5R,6R)-6-(1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl)-3,5-dihydroxy-4-methylheptan-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 134942492 |
| Molecular Formula | C31H56O7Si |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | (2R)-2-[(2R,3R,4R,5R,6R)-6-(1,4-dimethyl-2,8-dioxabicyclo[3.2.1]octan-3-yl)-3,5-dihydroxy-4-methylheptan-2-yl]-5-[tri(propan-2-yl)silyloxymethyl]-2,3-dihydropyran-6-one |
| SMILES | CC1C2CCC(C)(O2)OC1[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)[C@H]1CC=C(CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)O1 |
| InChI | InChI=1S/C31H56O7Si/c1-17(2)39(18(3)4,19(5)6)35-16-24-12-13-25(36-30(24)34)20(7)27(32)22(9)28(33)23(10)29-21(8)26-14-15-31(11,37-26)38-29/h12,17-23,25-29,32-33H,13-16H2,1-11H3/t20-,21?,22+,23+,25+,26?,27-,28+,29?,31?/m0/s1 |
| InChIKey | HQAUMJVATFUSNS-JEBLMENPSA-N |
| XLogP | 5.98 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|