C11H20O3 — CID 134942519
[(2S,3S)-3-[2-[(2S,3S)-3-ethyl-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methanol (PubChem CID 134942519) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is [(2S,3S)-3-[2-[(2S,3S)-3-ethyl-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[2-[(2S,3S)-3-ethyl-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 134942519 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | [(2S,3S)-3-[2-[(2S,3S)-3-ethyl-3-methyloxiran-2-yl]ethyl]-2-methyloxiran-2-yl]methanol |
| SMILES | CC[C@]1(C)O[C@H]1CC[C@@H]1O[C@@]1(C)CO |
| InChI | InChI=1S/C11H20O3/c1-4-10(2)8(13-10)5-6-9-11(3,7-12)14-9/h8-9,12H,4-7H2,1-3H3/t8-,9-,10-,11-/m0/s1 |
| InChIKey | ITRPIXGNUBOBGI-NAKRPEOUSA-N |
| XLogP | 1.48 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|