About CID 134942531
CID 134942531 (PubChem CID 134942531) has the molecular formula C8H12Li2OS2
and a molecular weight of 202.20 g/mol.
Molecular Properties
| Compound Name | CID 134942531 |
| PubChem CID | 134942531 |
| Molecular Formula | C8H12Li2OS2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | — |
| SMILES | [Li+].[Li+].[O-]C/C=C\C[C-]1SCCCS1 |
| InChI | InChI=1S/C8H12OS2.2Li/c9-5-2-1-4-8-10-6-3-7-11-8;;/h1-2H,3-7H2;;/q-2;2*+1/b2-1-;; |
| InChIKey | MBGBLFMVXXHGEM-UAIGNFCESA-N |
| XLogP | -4.34 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 134942531 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134942531?
The IUPAC name of CID 134942531 (CID 134942531) is not available.
What is the SMILES notation for CID 134942531?
The canonical SMILES for CID 134942531 is [Li+].[Li+].[O-]C/C=C\C[C-]1SCCCS1.
What is the InChIKey of CID 134942531?
The InChIKey is MBGBLFMVXXHGEM-UAIGNFCESA-N. The full InChI is InChI=1S/C8H12OS2.2Li/c9-5-2-1-4-8-10-6-3-7-11-8;;/h1-2H,3-7H2;;/q-2;2*+1/b2-1-;;.
What are the key properties of CID 134942531?
CID 134942531 has a molecular weight of 202.20 g/mol, XLogP of -4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134942531 is sourced from PubChem (CID 134942531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).