C16H28O4Si — CID 134942570
(1S,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)ethyl]cyclobut-2-ene-1-carbaldehyde (PubChem CID 134942570) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (1S,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)ethyl]cyclobut-2-ene-1-carbaldehyde.
| Compound Name | (1S,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)ethyl]cyclobut-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 134942570 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (1S,4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)ethyl]cyclobut-2-ene-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC1OCCO1)[C@@H]1C=C[C@@H]1C=O |
| InChI | InChI=1S/C16H28O4Si/c1-16(2,3)21(4,5)20-14(10-15-18-8-9-19-15)13-7-6-12(13)11-17/h6-7,11-15H,8-10H2,1-5H3/t12-,13-,14+/m1/s1 |
| InChIKey | ZCTICWXOXINXLY-MCIONIFRSA-N |
| XLogP | 3.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|