C36H26F4 — CID 134942678
2-[4-(9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene (PubChem CID 134942678) has the molecular formula C36H26F4 and a molecular weight of 534.60 g/mol. Its IUPAC name is 2-[4-(9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene.
| Compound Name | 2-[4-(9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 134942678 |
| Molecular Formula | C36H26F4 |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2-[4-(9,9-dimethylfluoren-2-yl)-2,3,5,6-tetrafluorophenyl]-9,9-dimethylfluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3c(F)c(F)c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)c(F)c3F)cc21 |
| InChI | InChI=1S/C36H26F4/c1-35(2)25-11-7-5-9-21(25)23-15-13-19(17-27(23)35)29-31(37)33(39)30(34(40)32(29)38)20-14-16-24-22-10-6-8-12-26(22)36(3,4)28(24)18-20/h5-18H,1-4H3 |
| InChIKey | OWHJPFWYGFKUSK-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|