C23H28N4O6 — CID 134942741
(8R,11R,14R)-4-hydroxy-5,11,13,14-tetramethyl-8-(methylamino)-18-nitro-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-9,12-dione (PubChem CID 134942741) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is (8R,11R,14R)-4-hydroxy-5,11,13,14-tetramethyl-8-(methylamino)-18-nitro-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-9,12-dione.
| Compound Name | (8R,11R,14R)-4-hydroxy-5,11,13,14-tetramethyl-8-(methylamino)-18-nitro-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-9,12-dione |
|---|---|
| PubChem CID | 134942741 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (8R,11R,14R)-4-hydroxy-5,11,13,14-tetramethyl-8-(methylamino)-18-nitro-2-oxa-10,13-diazatricyclo[14.2.2.13,7]henicosa-1(18),3,5,7(21),16,19-hexaene-9,12-dione |
| SMILES | CN[C@H]1C(=O)N[C@H](C)C(=O)N(C)[C@H](C)Cc2ccc(c([N+](=O)[O-])c2)Oc2cc1cc(C)c2O |
| InChI | InChI=1S/C23H28N4O6/c1-12-8-16-11-19(21(12)28)33-18-7-6-15(10-17(18)27(31)32)9-13(2)26(5)23(30)14(3)25-22(29)20(16)24-4/h6-8,10-11,13-14,20,24,28H,9H2,1-5H3,(H,25,29)/t13-,14-,20-/m1/s1 |
| InChIKey | OJHJDTXULCDCHL-ARGWCVDVSA-N |
| XLogP | 2.57 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|