About Dibutyl-lambda~2~-stannane--tributylstannyl (1/2)
Dibutyl-lambda~2~-stannane--tributylstannyl (1/2) (PubChem CID 13494282) has the molecular formula C32H72Sn3
and a molecular weight of 813.06 g/mol.
Molecular Properties
| Compound Name | Dibutyl-lambda~2~-stannane--tributylstannyl (1/2) |
| PubChem CID | 13494282 |
| Molecular Formula | C32H72Sn3 |
| Molecular Weight | 813.06 g/mol |
| Exact Mass | 816.27 |
| IUPAC Name | — |
| SMILES | CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC.CCCC[Sn]CCCC |
| InChI | InChI=1S/8C4H9.3Sn/c8*1-3-4-2;;;/h8*1,3-4H2,2H3;;; |
| InChIKey | ZBZRSJJBWTYLLY-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 813.06 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Dibutyl-lambda~2~-stannane--tributylstannyl (1/2) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dibutyl-lambda~2~-stannane--tributylstannyl (1/2)?
The IUPAC name of Dibutyl-lambda~2~-stannane--tributylstannyl (1/2) (CID 13494282) is not available.
What is the SMILES notation for Dibutyl-lambda~2~-stannane--tributylstannyl (1/2)?
The canonical SMILES for Dibutyl-lambda~2~-stannane--tributylstannyl (1/2) is CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC.CCCC[Sn]CCCC.
What is the InChIKey of Dibutyl-lambda~2~-stannane--tributylstannyl (1/2)?
The InChIKey is ZBZRSJJBWTYLLY-UHFFFAOYSA-N. The full InChI is InChI=1S/8C4H9.3Sn/c8*1-3-4-2;;;/h8*1,3-4H2,2H3;;;.
What are the key properties of Dibutyl-lambda~2~-stannane--tributylstannyl (1/2)?
Dibutyl-lambda~2~-stannane--tributylstannyl (1/2) has a molecular weight of 813.06 g/mol, XLogP of 12.89, 24 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Dibutyl-lambda~2~-stannane--tributylstannyl (1/2) is sourced from PubChem (CID 13494282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).