C18H10F4 — CID 134942827
15,16-bis(difluoromethylidene)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 134942827) has the molecular formula C18H10F4 and a molecular weight of 302.27 g/mol. Its IUPAC name is 15,16-bis(difluoromethylidene)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | 15,16-bis(difluoromethylidene)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 134942827 |
| Molecular Formula | C18H10F4 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 15,16-bis(difluoromethylidene)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | FC(F)=C1C(=C(F)F)C2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C18H10F4/c19-17(20)15-13-9-5-1-2-6-10(9)14(16(15)18(21)22)12-8-4-3-7-11(12)13/h1-8,13-14H |
| InChIKey | XWLYBGQJLRBNMG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |