C23H32INO2 — CID 134942836
(3R)-3-hex-5-enyl-5-iodo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one (PubChem CID 134942836) has the molecular formula C23H32INO2 and a molecular weight of 481.42 g/mol. Its IUPAC name is (3R)-3-hex-5-enyl-5-iodo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one.
| Compound Name | (3R)-3-hex-5-enyl-5-iodo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 134942836 |
| Molecular Formula | C23H32INO2 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (3R)-3-hex-5-enyl-5-iodo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-2-one |
| SMILES | C=CCCCC[C@@H]1CC(I)=CN(CCCCCOCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H32INO2/c1-2-3-4-9-14-21-17-22(24)18-25(23(21)26)15-10-6-11-16-27-19-20-12-7-5-8-13-20/h2,5,7-8,12-13,18,21H,1,3-4,6,9-11,14-17,19H2/t21-/m1/s1 |
| InChIKey | VNPFSVYMPWISLC-OAQYLSRUSA-N |
| XLogP | 6.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|