C12H8F4 — CID 134942847
(2Z,4E)-9,10-bis(difluoromethylidene)bicyclo[4.2.2]deca-2,4,7-triene (PubChem CID 134942847) has the molecular formula C12H8F4 and a molecular weight of 228.19 g/mol. Its IUPAC name is (2Z,4E)-9,10-bis(difluoromethylidene)bicyclo[4.2.2]deca-2,4,7-triene.
| Compound Name | (2Z,4E)-9,10-bis(difluoromethylidene)bicyclo[4.2.2]deca-2,4,7-triene |
|---|---|
| PubChem CID | 134942847 |
| Molecular Formula | C12H8F4 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (2Z,4E)-9,10-bis(difluoromethylidene)bicyclo[4.2.2]deca-2,4,7-triene |
| SMILES | FC(F)=C1C(=C(F)F)C2C=CC1/C=C\C=C/2 |
| InChI | InChI=1S/C12H8F4/c13-11(14)9-7-3-1-2-4-8(6-5-7)10(9)12(15)16/h1-8H/b3-1-,4-2- |
| InChIKey | XXUOBGRNZUCCNY-CCAGOZQPSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|