About methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate
methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate (PubChem CID 134942938) has the molecular formula C15H11Cl3N2O3
and a molecular weight of 373.62 g/mol. Its IUPAC name is methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate |
| PubChem CID | 134942938 |
| Molecular Formula | C15H11Cl3N2O3 |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2cc(Cl)cc(Cl)c2Cl)c(NC(C)=O)n1 |
| InChI | InChI=1S/C15H11Cl3N2O3/c1-7(21)19-14-9(3-4-12(20-14)15(22)23-2)10-5-8(16)6-11(17)13(10)18/h3-6H,1-2H3,(H,19,20,21) |
| InChIKey | VYWVVLVRCFIWAO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate?
The IUPAC name of methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate (CID 134942938) is methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate?
The canonical SMILES for methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate is COC(=O)c1ccc(-c2cc(Cl)cc(Cl)c2Cl)c(NC(C)=O)n1.
What is the InChIKey of methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate?
The InChIKey is VYWVVLVRCFIWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl3N2O3/c1-7(21)19-14-9(3-4-12(20-14)15(22)23-2)10-5-8(16)6-11(17)13(10)18/h3-6H,1-2H3,(H,19,20,21).
What are the key properties of methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate?
methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate has a molecular weight of 373.62 g/mol, XLogP of 4.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-acetamido-5-(2,3,5-trichlorophenyl)pyridine-2-carboxylate is sourced from PubChem (CID 134942938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).