About (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile
(2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile (PubChem CID 134943071) has the molecular formula C23H31NO3
and a molecular weight of 369.51 g/mol. Its IUPAC name is (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile.
Molecular Properties
| Compound Name | (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile |
| PubChem CID | 134943071 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile |
| SMILES | COc1cc(CC/C=C(\C#N)CCC=C(C)CCCCC=O)cc(OC)c1 |
| InChI | InChI=1S/C23H31NO3/c1-19(9-5-4-6-14-25)10-7-11-20(18-24)12-8-13-21-15-22(26-2)17-23(16-21)27-3/h10,12,14-17H,4-9,11,13H2,1-3H3/b19-10?,20-12- |
| InChIKey | PGDINTYOMNNBAM-LLCRGYOOSA-N |
| XLogP | 5.57 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile?
The IUPAC name of (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile (CID 134943071) is (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile.
What is the SMILES notation for (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile?
The canonical SMILES for (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile is COc1cc(CC/C=C(\C#N)CCC=C(C)CCCCC=O)cc(OC)c1.
What is the InChIKey of (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile?
The InChIKey is PGDINTYOMNNBAM-LLCRGYOOSA-N. The full InChI is InChI=1S/C23H31NO3/c1-19(9-5-4-6-14-25)10-7-11-20(18-24)12-8-13-21-15-22(26-2)17-23(16-21)27-3/h10,12,14-17H,4-9,11,13H2,1-3H3/b19-10?,20-12-.
What are the key properties of (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile?
(2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile has a molecular weight of 369.51 g/mol, XLogP of 5.57, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[3-(3,5-dimethoxyphenyl)propylidene]-6-methyl-11-oxoundec-5-enenitrile is sourced from PubChem (CID 134943071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).