C18H26O6 — CID 134943184
diethyl (4aR,5Z,8aR)-5-ethylidene-8a-methyl-2-oxo-4,4a,6,8-tetrahydro-3H-chromene-7,7-dicarboxylate (PubChem CID 134943184) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is diethyl (4aR,5Z,8aR)-5-ethylidene-8a-methyl-2-oxo-4,4a,6,8-tetrahydro-3H-chromene-7,7-dicarboxylate.
| Compound Name | diethyl (4aR,5Z,8aR)-5-ethylidene-8a-methyl-2-oxo-4,4a,6,8-tetrahydro-3H-chromene-7,7-dicarboxylate |
|---|---|
| PubChem CID | 134943184 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | diethyl (4aR,5Z,8aR)-5-ethylidene-8a-methyl-2-oxo-4,4a,6,8-tetrahydro-3H-chromene-7,7-dicarboxylate |
| SMILES | C/C=C1/CC(C(=O)OCC)(C(=O)OCC)C[C@@]2(C)OC(=O)CC[C@H]12 |
| InChI | InChI=1S/C18H26O6/c1-5-12-10-18(15(20)22-6-2,16(21)23-7-3)11-17(4)13(12)8-9-14(19)24-17/h5,13H,6-11H2,1-4H3/b12-5-/t13-,17-/m1/s1 |
| InChIKey | ODIIKJWLYAJCNO-DAKHSERISA-N |
| XLogP | 2.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|