About (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde
(5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde (PubChem CID 134943257) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde.
Molecular Properties
| Compound Name | (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde |
| PubChem CID | 134943257 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde |
| SMILES | CN1O[C@](C)(C=O)CC1c1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-12(9-14)8-11(13(2)15-12)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | QJSWWWXNXKRLMG-KIYNQFGBSA-N |
| XLogP | 1.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde?
The IUPAC name of (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde (CID 134943257) is (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde.
What is the SMILES notation for (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde?
The canonical SMILES for (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde is CN1O[C@](C)(C=O)CC1c1ccccc1.
What is the InChIKey of (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde?
The InChIKey is QJSWWWXNXKRLMG-KIYNQFGBSA-N. The full InChI is InChI=1S/C12H15NO2/c1-12(9-14)8-11(13(2)15-12)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t11?,12-/m0/s1.
What are the key properties of (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde?
(5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde has a molecular weight of 205.26 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,5-dimethyl-3-phenyl-1,2-oxazolidine-5-carbaldehyde is sourced from PubChem (CID 134943257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).