C22H40O5Si2 — CID 134943297
4,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 134943297) has the molecular formula C22H40O5Si2 and a molecular weight of 440.73 g/mol. Its IUPAC name is 4,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 4,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 134943297 |
| Molecular Formula | C22H40O5Si2 |
| Molecular Weight | 440.73 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 4,7-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C=CC(CO[Si](C)(C)C(C)(C)C)C2C(=O)OC(=O)C12 |
| InChI | InChI=1S/C22H40O5Si2/c1-21(2,3)28(7,8)25-13-15-11-12-16(14-26-29(9,10)22(4,5)6)18-17(15)19(23)27-20(18)24/h11-12,15-18H,13-14H2,1-10H3 |
| InChIKey | STEDPPIREQOTMO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|