C19H20O3 — CID 134943339
(3aS,4R,6S,6aR)-6-ethenyl-3a,6a-dimethyl-4-[(E)-2-phenylethenyl]-5,6-dihydro-4H-cyclopenta[c]furan-1,3-dione (PubChem CID 134943339) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3aS,4R,6S,6aR)-6-ethenyl-3a,6a-dimethyl-4-[(E)-2-phenylethenyl]-5,6-dihydro-4H-cyclopenta[c]furan-1,3-dione.
| Compound Name | (3aS,4R,6S,6aR)-6-ethenyl-3a,6a-dimethyl-4-[(E)-2-phenylethenyl]-5,6-dihydro-4H-cyclopenta[c]furan-1,3-dione |
|---|---|
| PubChem CID | 134943339 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3aS,4R,6S,6aR)-6-ethenyl-3a,6a-dimethyl-4-[(E)-2-phenylethenyl]-5,6-dihydro-4H-cyclopenta[c]furan-1,3-dione |
| SMILES | C=C[C@@H]1C[C@H](/C=C/c2ccccc2)[C@]2(C)C(=O)OC(=O)[C@]12C |
| InChI | InChI=1S/C19H20O3/c1-4-14-12-15(11-10-13-8-6-5-7-9-13)19(3)17(21)22-16(20)18(14,19)2/h4-11,14-15H,1,12H2,2-3H3/b11-10+/t14-,15+,18+,19-/m1/s1 |
| InChIKey | OQTFSWLKCXIFRG-DUHZEGMKSA-N |
| XLogP | 3.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|