C12H28NO3Si+ — CID 134943499
3-[(4S,6R)-2-methoxy-4,6-dimethyl-1,3,2-dioxasilinan-2-yl]propyl-trimethylazanium (PubChem CID 134943499) has the molecular formula C12H28NO3Si+ and a molecular weight of 262.45 g/mol. Its IUPAC name is 3-[(4S,6R)-2-methoxy-4,6-dimethyl-1,3,2-dioxasilinan-2-yl]propyl-trimethylazanium.
| Compound Name | 3-[(4S,6R)-2-methoxy-4,6-dimethyl-1,3,2-dioxasilinan-2-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 134943499 |
| Molecular Formula | C12H28NO3Si+ |
| Molecular Weight | 262.45 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-[(4S,6R)-2-methoxy-4,6-dimethyl-1,3,2-dioxasilinan-2-yl]propyl-trimethylazanium |
| SMILES | CO[Si]1(CCC[N+](C)(C)C)O[C@H](C)C[C@H](C)O1 |
| InChI | InChI=1S/C12H28NO3Si/c1-11-10-12(2)16-17(14-6,15-11)9-7-8-13(3,4)5/h11-12H,7-10H2,1-6H3/q+1/t11-,12+,17? |
| InChIKey | ACIZIEJSGUEJIY-GTKHYJCHSA-N |
| XLogP | 1.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|