C24H21N3O12 — CID 134943537
2,3,6,7,10,11-hexamethoxy-1,5,9-trinitrotriphenylene (PubChem CID 134943537) has the molecular formula C24H21N3O12 and a molecular weight of 543.44 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexamethoxy-1,5,9-trinitrotriphenylene.
| Compound Name | 2,3,6,7,10,11-hexamethoxy-1,5,9-trinitrotriphenylene |
|---|---|
| PubChem CID | 134943537 |
| Molecular Formula | C24H21N3O12 |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 2,3,6,7,10,11-hexamethoxy-1,5,9-trinitrotriphenylene |
| SMILES | COc1cc2c(c([N+](=O)[O-])c1OC)c1cc(OC)c(OC)c([N+](=O)[O-])c1c1cc(OC)c(OC)c([N+](=O)[O-])c21 |
| InChI | InChI=1S/C24H21N3O12/c1-34-13-7-10-16(19(25(28)29)22(13)37-4)11-8-14(35-2)24(39-6)21(27(32)33)18(11)12-9-15(36-3)23(38-5)20(17(10)12)26(30)31/h7-9H,1-6H3 |
| InChIKey | ATVRUZHAFYWCAQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 184.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|