About 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline
2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline (PubChem CID 134943542) has the molecular formula C26H24N2
and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline.
Molecular Properties
| Compound Name | 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline |
| PubChem CID | 134943542 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline |
| SMILES | C(=C/[C@@H](CCc1ccccc1)Cc1cnc2ccccc2n1)\c1ccccc1 |
| InChI | InChI=1S/C26H24N2/c1-3-9-21(10-4-1)15-17-23(18-16-22-11-5-2-6-12-22)19-24-20-27-25-13-7-8-14-26(25)28-24/h1-15,17,20,23H,16,18-19H2/b17-15+/t23-/m0/s1 |
| InChIKey | GGNLAFCQRRWGEZ-GGJDQLKOSA-N |
| XLogP | 6.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline?
The IUPAC name of 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline (CID 134943542) is 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline.
What is the SMILES notation for 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline?
The canonical SMILES for 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline is C(=C/[C@@H](CCc1ccccc1)Cc1cnc2ccccc2n1)\c1ccccc1.
What is the InChIKey of 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline?
The InChIKey is GGNLAFCQRRWGEZ-GGJDQLKOSA-N. The full InChI is InChI=1S/C26H24N2/c1-3-9-21(10-4-1)15-17-23(18-16-22-11-5-2-6-12-22)19-24-20-27-25-13-7-8-14-26(25)28-24/h1-15,17,20,23H,16,18-19H2/b17-15+/t23-/m0/s1.
What are the key properties of 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline?
2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline has a molecular weight of 364.49 g/mol, XLogP of 6.13, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,2S)-4-phenyl-2-(2-phenylethyl)but-3-enyl]quinoxaline is sourced from PubChem (CID 134943542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).