C17H28O6Si — CID 134943726
triethyl 5-trimethylsilylpenta-3,4-diene-1,1,1-tricarboxylate (PubChem CID 134943726) has the molecular formula C17H28O6Si and a molecular weight of 356.49 g/mol. Its IUPAC name is triethyl 5-trimethylsilylpenta-3,4-diene-1,1,1-tricarboxylate.
| Compound Name | triethyl 5-trimethylsilylpenta-3,4-diene-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 134943726 |
| Molecular Formula | C17H28O6Si |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | triethyl 5-trimethylsilylpenta-3,4-diene-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(CC=C=C[Si](C)(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H28O6Si/c1-7-21-14(18)17(15(19)22-8-2,16(20)23-9-3)12-10-11-13-24(4,5)6/h10,13H,7-9,12H2,1-6H3 |
| InChIKey | KAMMZVYBIMSYDD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|