About diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate
diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate (PubChem CID 134943727) has the molecular formula C19H34O6Si
and a molecular weight of 386.56 g/mol. Its IUPAC name is diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate.
Molecular Properties
| Compound Name | diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate |
| PubChem CID | 134943727 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate |
| SMILES | CCOC(=O)C(CC(C)=C=C[Si](C)(C)C)(CC(OC)OC)C(=O)OCC |
| InChI | InChI=1S/C19H34O6Si/c1-9-24-17(20)19(18(21)25-10-2,14-16(22-4)23-5)13-15(3)11-12-26(6,7)8/h12,16H,9-10,13-14H2,1-8H3 |
| InChIKey | LEJJQDCLZOJLRI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate?
The IUPAC name of diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate (CID 134943727) is diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate.
What is the SMILES notation for diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate?
The canonical SMILES for diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate is CCOC(=O)C(CC(C)=C=C[Si](C)(C)C)(CC(OC)OC)C(=O)OCC.
What is the InChIKey of diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate?
The InChIKey is LEJJQDCLZOJLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O6Si/c1-9-24-17(20)19(18(21)25-10-2,14-16(22-4)23-5)13-15(3)11-12-26(6,7)8/h12,16H,9-10,13-14H2,1-8H3.
What are the key properties of diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate?
diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate has a molecular weight of 386.56 g/mol, XLogP of 3.48, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(2,2-dimethoxyethyl)-2-(2-methyl-4-trimethylsilylbuta-2,3-dienyl)propanedioate is sourced from PubChem (CID 134943727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).