C15H25LiN4O4 — CID 134943867
lithium (2S,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 134943867) has the molecular formula C15H25LiN4O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is lithium (2S,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | lithium (2S,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 134943867 |
| Molecular Formula | C15H25LiN4O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | lithium (2S,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-2-(2-ethylbutyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCC(CC)C[C@@H]1OC(C(=O)[O-])=C[C@H](N=C(N)N)[C@H]1NC(C)=O.[Li+] |
| InChI | InChI=1S/C15H26N4O4.Li/c1-4-9(5-2)6-11-13(18-8(3)20)10(19-15(16)17)7-12(23-11)14(21)22;/h7,9-11,13H,4-6H2,1-3H3,(H,18,20)(H,21,22)(H4,16,17,19);/q;+1/p-1/t10-,11-,13+;/m0./s1 |
| InChIKey | QXPDMHOQAGAWQF-VDWBQBBKSA-M |
| XLogP | -4.00 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|