About methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate
methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate (PubChem CID 134943934) has the molecular formula C16H32O3Si
and a molecular weight of 300.51 g/mol. Its IUPAC name is methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate.
Molecular Properties
| Compound Name | methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate |
| PubChem CID | 134943934 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate |
| SMILES | COC(=O)/C=C/C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-15(2,3)13(11-10-12-14(17)18-7)19-20(8,9)16(4,5)6/h10,12-13H,11H2,1-9H3/b12-10+/t13-/m1/s1 |
| InChIKey | YKUVIJICIIEFEK-RSKUSDAESA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate?
The IUPAC name of methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate (CID 134943934) is methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate.
What is the SMILES notation for methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate?
The canonical SMILES for methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate is COC(=O)/C=C/C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate?
The InChIKey is YKUVIJICIIEFEK-RSKUSDAESA-N. The full InChI is InChI=1S/C16H32O3Si/c1-15(2,3)13(11-10-12-14(17)18-7)19-20(8,9)16(4,5)6/h10,12-13H,11H2,1-9H3/b12-10+/t13-/m1/s1.
What are the key properties of methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate?
methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate has a molecular weight of 300.51 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethylhept-2-enoate is sourced from PubChem (CID 134943934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).