C28H20N2S3 — CID 134944040
(6S,7S)-6,7-dimethyl-4,9-diphenyl-5,8,19-trithia-3,10-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,3,9,11,13,15,17-heptaene (PubChem CID 134944040) has the molecular formula C28H20N2S3 and a molecular weight of 480.68 g/mol. Its IUPAC name is (6S,7S)-6,7-dimethyl-4,9-diphenyl-5,8,19-trithia-3,10-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,3,9,11,13,15,17-heptaene.
| Compound Name | (6S,7S)-6,7-dimethyl-4,9-diphenyl-5,8,19-trithia-3,10-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,3,9,11,13,15,17-heptaene |
|---|---|
| PubChem CID | 134944040 |
| Molecular Formula | C28H20N2S3 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | (6S,7S)-6,7-dimethyl-4,9-diphenyl-5,8,19-trithia-3,10-diazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1,3,9,11,13,15,17-heptaene |
| SMILES | C[C@]12SC(c3ccccc3)=NC1=c1sc3ccccc3c1=C1N=C(c3ccccc3)S[C@@]12C |
| InChI | InChI=1S/C28H20N2S3/c1-27-23(29-25(32-27)17-11-5-3-6-12-17)21-19-15-9-10-16-20(19)31-22(21)24-28(27,2)33-26(30-24)18-13-7-4-8-14-18/h3-16H,1-2H3/t27-,28-/m0/s1 |
| InChIKey | LHMCBWSWXPDTQM-NSOVKSMOSA-N |
| XLogP | 6.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |