C28H17O4 — CID 134944070
CID 134944070 (PubChem CID 134944070) has the molecular formula C28H17O4 and a molecular weight of 417.44 g/mol.
| Compound Name | CID 134944070 |
|---|---|
| PubChem CID | 134944070 |
| Molecular Formula | C28H17O4 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | — |
| SMILES | [O]O[C@]12c3ccccc3O[C@@]1(c1ccccc1)c1ccccc1-c1oc3ccccc3c12 |
| InChI | InChI=1S/C28H17O4/c29-32-28-22-15-7-9-17-24(22)31-27(28,18-10-2-1-3-11-18)21-14-6-4-12-19(21)26-25(28)20-13-5-8-16-23(20)30-26/h1-17H/t27-,28-/m0/s1 |
| InChIKey | BFBNUDLPKLVAQX-NSOVKSMOSA-N |
| XLogP | 6.36 |
| TPSA | 51.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|