C22H28O6 — CID 134944093
(1S,3aS,9R,9aS)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enoyl]-9-methoxy-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione (PubChem CID 134944093) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is (1S,3aS,9R,9aS)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enoyl]-9-methoxy-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione.
| Compound Name | (1S,3aS,9R,9aS)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enoyl]-9-methoxy-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione |
|---|---|
| PubChem CID | 134944093 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (1S,3aS,9R,9aS)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enoyl]-9-methoxy-1,4-dimethyl-3,3a,9,9a-tetrahydro-2H-cyclopenta[g]naphthalene-5,8-dione |
| SMILES | CO[C@H]1C2=C(C(=O)C=CC2=O)C(C)(C(=O)[C@H](O)C=C(C)C)[C@H]2CC[C@](C)(O)[C@H]12 |
| InChI | InChI=1S/C22H28O6/c1-11(2)10-15(25)20(26)22(4)12-8-9-21(3,27)17(12)19(28-5)16-13(23)6-7-14(24)18(16)22/h6-7,10,12,15,17,19,25,27H,8-9H2,1-5H3/t12-,15+,17-,19-,21-,22?/m0/s1 |
| InChIKey | YSUUORLSDSFOTP-SDJOYBISSA-N |
| XLogP | 1.70 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|